ChemNet > CAS > 374538-04-2 4-Cyclohexylbenzeneboronic acid
374538-04-2 4-Cyclohexylbenzeneboronic acid
Nama produk |
4-Cyclohexylbenzeneboronic acid |
Sinonim |
4-Cyclohexylphenylboronic acid |
MF |
C12H17BO2 |
Berat Molekul |
204.0732 |
InChI |
InChI=1/C12H17BO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10,14-15H,1-5H2 |
CAS NO |
374538-04-2 |
Struktur Molekul |
|
Kepadatan |
1.09g/cm3 |
Titik didih |
363.7°C at 760 mmHg |
Indeks bias |
1.543 |
Titik nyala |
173.8°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|